White Powder Methyl 2-Amino-5-Chlorobenzoate Manufacturing

Specification of thisChina Methyl 2-Amino-5-ChlorobenzoateMethyl 2-amino-5-chlorobenzoate is a white or off-white crystalline powder.Its synonyms are White Methyl 2-Amino-5-Chlorobenzoate acid methyl ester; 5-Chloroanthranilic acid methyl ester; Methyl 5-chloroanthranilate; Benzoic acid,2-amino-5-chloro-, methyl ester; Anthranilicacid, 5-chloro-, methyl ester (6CI,7CI,8CI); 2-Amino-5-chlorobenzoic acidmethyl ester; Methyl2-amino-5-chlorobenzoate; 5-chloro-3-methyl-2-methyl anthranilate; 2-Amino-5-Chlorobenzonic acid methyl ester.It is a pesticide intermediate and a pharmaceutical intermediate.Parameters of thisMethyl 2-Amino-5-Chlorobenzoate Suppliers
|
product Name |
methyl 2-amino-5-chlorobenzoate |
|
Synonyms |
2-Amino-5-chlorobenzoic acid methyl ester; 5-Chloroanthranilic acid methyl ester; Methyl 5-chloroanthranilate; Benzoic acid,2-amino-5-chloro-, methyl ester; Anthranilicacid, 5-chloro-, methyl ester (6CI,7CI,8CI); 2-Amino-5-chlorobenzoic acidmethyl ester; Methyl2-amino-5-chlorobenzoate; 5-chloro-3-methyl-2-methyl anthranilate; 2-Amino-5-Chlorobenzonic acid methyl ester |
|
Molecular Formula |
C8H8ClNO2 |
|
Molecular Weight |
185.6076 |
|
InChI |
InChI=1/C8H8ClNO2/c1-12-8(11)6-4-5(9)2-3-7(6)10/h2-4H,10H2,1H3 |
|
CAS Registry Number |
5202-89-1 |
|
EINECS |
225-992-4 |
|
Molecular Structure |
![]() |
|
Density |
1.311g/cm3 |
|
Melting point |
66-68℃ |
|
Boiling point |
293.9°C at 760 mmHg |
|
Refractive index |
1.58 |
|
Flash point |
131.5°C |
|
Water solubility |
AUTOIGNITION |
|
Vapour Pressur |
0.00168mmHg at 25°C |





Looking forward to your inquiry for this White Powder Methyl 2-Amino-5-ChlorobenzoateManufacturers
TAGS
pharmaceutical intermediates






![White Powder 2-[4-[(2-Oxocyclopentan-1-yl)methyl]phenyl]propionic Acid Supplier](http://cdncn.goodao.net/interchinachem/x1oha2vbexp.png)

